C20H20N2O7 — CID 2586739
[(2R)-1-(3-nitroanilino)-1-oxopropan-2-yl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate (PubChem CID 2586739) has the molecular formula C20H20N2O7 and a molecular weight of 400.39 g/mol. Its IUPAC name is [(2R)-1-(3-nitroanilino)-1-oxopropan-2-yl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(3-nitroanilino)-1-oxopropan-2-yl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2586739 |
| Molecular Formula | C20H20N2O7 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | [(2R)-1-(3-nitroanilino)-1-oxopropan-2-yl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(/C=C/C(=O)O[C@H](C)C(=O)Nc2cccc([N+](=O)[O-])c2)c1OC |
| InChI | InChI=1S/C20H20N2O7/c1-13(20(24)21-15-7-5-8-16(12-15)22(25)26)29-18(23)11-10-14-6-4-9-17(27-2)19(14)28-3/h4-13H,1-3H3,(H,21,24)/b11-10+/t13-/m1/s1 |
| InChIKey | WSJAXTBLIXCGPB-OCHBPSSRSA-N |
| XLogP | 3.20 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|