C20H17ClO5 — CID 102464849
2-[3-[2-[(E)-3-(4-chlorophenyl)prop-2-enoyl]oxyacetyl]-4-methylphenyl]acetic acid (PubChem CID 102464849) has the molecular formula C20H17ClO5 and a molecular weight of 372.80 g/mol. Its IUPAC name is 2-[3-[2-[(E)-3-(4-chlorophenyl)prop-2-enoyl]oxyacetyl]-4-methylphenyl]acetic acid.
| Compound Name | 2-[3-[2-[(E)-3-(4-chlorophenyl)prop-2-enoyl]oxyacetyl]-4-methylphenyl]acetic acid |
|---|---|
| PubChem CID | 102464849 |
| Molecular Formula | C20H17ClO5 |
| Molecular Weight | 372.80 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 2-[3-[2-[(E)-3-(4-chlorophenyl)prop-2-enoyl]oxyacetyl]-4-methylphenyl]acetic acid |
| SMILES | Cc1ccc(CC(=O)O)cc1C(=O)COC(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17ClO5/c1-13-2-3-15(11-19(23)24)10-17(13)18(22)12-26-20(25)9-6-14-4-7-16(21)8-5-14/h2-10H,11-12H2,1H3,(H,23,24)/b9-6+ |
| InChIKey | RDSQIJHDLOWONU-RMKNXTFCSA-N |
| XLogP | 3.71 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.80 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|