About (4-carbamoyl-2-nitrophenyl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate
(4-carbamoyl-2-nitrophenyl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 27314652) has the molecular formula C20H20N2O8
and a molecular weight of 416.39 g/mol. Its IUPAC name is (4-carbamoyl-2-nitrophenyl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | (4-carbamoyl-2-nitrophenyl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| PubChem CID | 27314652 |
| Molecular Formula | C20H20N2O8 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | (4-carbamoyl-2-nitrophenyl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCc2ccc(C(N)=O)cc2[N+](=O)[O-])cc(OC)c1OC |
| InChI | InChI=1S/C20H20N2O8/c1-27-16-8-12(9-17(28-2)19(16)29-3)4-7-18(23)30-11-14-6-5-13(20(21)24)10-15(14)22(25)26/h4-10H,11H2,1-3H3,(H2,21,24)/b7-4+ |
| InChIKey | XCEFYWAAWUDIGU-QPJJXVBHSA-N |
| XLogP | 2.48 |
| TPSA | 140.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-carbamoyl-2-nitrophenyl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-carbamoyl-2-nitrophenyl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate?
The IUPAC name of (4-carbamoyl-2-nitrophenyl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (CID 27314652) is (4-carbamoyl-2-nitrophenyl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
What is the SMILES notation for (4-carbamoyl-2-nitrophenyl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate?
The canonical SMILES for (4-carbamoyl-2-nitrophenyl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate is COc1cc(/C=C/C(=O)OCc2ccc(C(N)=O)cc2[N+](=O)[O-])cc(OC)c1OC.
What is the InChIKey of (4-carbamoyl-2-nitrophenyl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate?
The InChIKey is XCEFYWAAWUDIGU-QPJJXVBHSA-N. The full InChI is InChI=1S/C20H20N2O8/c1-27-16-8-12(9-17(28-2)19(16)29-3)4-7-18(23)30-11-14-6-5-13(20(21)24)10-15(14)22(25)26/h4-10H,11H2,1-3H3,(H2,21,24)/b7-4+.
What are the key properties of (4-carbamoyl-2-nitrophenyl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate?
(4-carbamoyl-2-nitrophenyl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate has a molecular weight of 416.39 g/mol, XLogP of 2.48, 9 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-carbamoyl-2-nitrophenyl)methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate is sourced from PubChem (CID 27314652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).