C14H14N2O5 — CID 27314123
(4-carbamoyl-2-nitrophenyl)methyl (2E,4E)-hexa-2,4-dienoate (PubChem CID 27314123) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is (4-carbamoyl-2-nitrophenyl)methyl (2E,4E)-hexa-2,4-dienoate.
| Compound Name | (4-carbamoyl-2-nitrophenyl)methyl (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 27314123 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (4-carbamoyl-2-nitrophenyl)methyl (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)OCc1ccc(C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H14N2O5/c1-2-3-4-5-13(17)21-9-11-7-6-10(14(15)18)8-12(11)16(19)20/h2-8H,9H2,1H3,(H2,15,18)/b3-2+,5-4+ |
| InChIKey | VLPCNTRYFYOZKT-MQQKCMAXSA-N |
| XLogP | 1.87 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|