C18H24N2O5 — CID 154049010
[2,6-dimethoxy-4-[3-oxo-3-(piperidin-1-ylamino)prop-1-enyl]phenyl] acetate (PubChem CID 154049010) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[3-oxo-3-(piperidin-1-ylamino)prop-1-enyl]phenyl] acetate.
| Compound Name | [2,6-dimethoxy-4-[3-oxo-3-(piperidin-1-ylamino)prop-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 154049010 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | [2,6-dimethoxy-4-[3-oxo-3-(piperidin-1-ylamino)prop-1-enyl]phenyl] acetate |
| SMILES | COc1cc(C=CC(=O)NN2CCCCC2)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C18H24N2O5/c1-13(21)25-18-15(23-2)11-14(12-16(18)24-3)7-8-17(22)19-20-9-5-4-6-10-20/h7-8,11-12H,4-6,9-10H2,1-3H3,(H,19,22) |
| InChIKey | GUBQHLFSXGMWNS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|