C15H15F2N3O — CID 143694332
1-(3-amino-4-methylphenyl)-3-(2,4-difluoro-6-methylphenyl)urea (PubChem CID 143694332) has the molecular formula C15H15F2N3O and a molecular weight of 291.30 g/mol. Its IUPAC name is 1-(3-amino-4-methylphenyl)-3-(2,4-difluoro-6-methylphenyl)urea.
| Compound Name | 1-(3-amino-4-methylphenyl)-3-(2,4-difluoro-6-methylphenyl)urea |
|---|---|
| PubChem CID | 143694332 |
| Molecular Formula | C15H15F2N3O |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 1-(3-amino-4-methylphenyl)-3-(2,4-difluoro-6-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2c(C)cc(F)cc2F)cc1N |
| InChI | InChI=1S/C15H15F2N3O/c1-8-3-4-11(7-13(8)18)19-15(21)20-14-9(2)5-10(16)6-12(14)17/h3-7H,18H2,1-2H3,(H2,19,20,21) |
| InChIKey | OOYMBHXBBUFELL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|