C12H14F2N2O4 — CID 107839612
4-[(2,4-difluorophenyl)methylcarbamoylamino]-2-hydroxybutanoic acid (PubChem CID 107839612) has the molecular formula C12H14F2N2O4 and a molecular weight of 288.25 g/mol. Its IUPAC name is 4-[(2,4-difluorophenyl)methylcarbamoylamino]-2-hydroxybutanoic acid.
| Compound Name | 4-[(2,4-difluorophenyl)methylcarbamoylamino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107839612 |
| Molecular Formula | C12H14F2N2O4 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-[(2,4-difluorophenyl)methylcarbamoylamino]-2-hydroxybutanoic acid |
| SMILES | O=C(NCCC(O)C(=O)O)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C12H14F2N2O4/c13-8-2-1-7(9(14)5-8)6-16-12(20)15-4-3-10(17)11(18)19/h1-2,5,10,17H,3-4,6H2,(H,18,19)(H2,15,16,20) |
| InChIKey | XRMAOTGVIPROFH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |