C25H25N3O2 — CID 46384350
1-(3,4-dimethylphenyl)-3-[1-(4-methylbenzoyl)-2,3-dihydroindol-6-yl]urea (PubChem CID 46384350) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[1-(4-methylbenzoyl)-2,3-dihydroindol-6-yl]urea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[1-(4-methylbenzoyl)-2,3-dihydroindol-6-yl]urea |
|---|---|
| PubChem CID | 46384350 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[1-(4-methylbenzoyl)-2,3-dihydroindol-6-yl]urea |
| SMILES | Cc1ccc(C(=O)N2CCc3ccc(NC(=O)Nc4ccc(C)c(C)c4)cc32)cc1 |
| InChI | InChI=1S/C25H25N3O2/c1-16-4-7-20(8-5-16)24(29)28-13-12-19-9-11-22(15-23(19)28)27-25(30)26-21-10-6-17(2)18(3)14-21/h4-11,14-15H,12-13H2,1-3H3,(H2,26,27,30) |
| InChIKey | YFGVTNSKWAOGGI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |