C24H21N3O4 — CID 46384390
1-(1,3-benzodioxol-5-yl)-3-[1-(4-methylbenzoyl)-2,3-dihydroindol-6-yl]urea (PubChem CID 46384390) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[1-(4-methylbenzoyl)-2,3-dihydroindol-6-yl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[1-(4-methylbenzoyl)-2,3-dihydroindol-6-yl]urea |
|---|---|
| PubChem CID | 46384390 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[1-(4-methylbenzoyl)-2,3-dihydroindol-6-yl]urea |
| SMILES | Cc1ccc(C(=O)N2CCc3ccc(NC(=O)Nc4ccc5c(c4)OCO5)cc32)cc1 |
| InChI | InChI=1S/C24H21N3O4/c1-15-2-4-17(5-3-15)23(28)27-11-10-16-6-7-18(12-20(16)27)25-24(29)26-19-8-9-21-22(13-19)31-14-30-21/h2-9,12-13H,10-11,14H2,1H3,(H2,25,26,29) |
| InChIKey | CEBFZOCBWNMXND-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |