C16H12Cl2N2O2S — CID 57009467
3,5-dichloro-N-[2-(6-hydroxy-1,3-benzothiazol-2-yl)ethyl]benzamide (PubChem CID 57009467) has the molecular formula C16H12Cl2N2O2S and a molecular weight of 367.26 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(6-hydroxy-1,3-benzothiazol-2-yl)ethyl]benzamide.
| Compound Name | 3,5-dichloro-N-[2-(6-hydroxy-1,3-benzothiazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 57009467 |
| Molecular Formula | C16H12Cl2N2O2S |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 3,5-dichloro-N-[2-(6-hydroxy-1,3-benzothiazol-2-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1nc2ccc(O)cc2s1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2N2O2S/c17-10-5-9(6-11(18)7-10)16(22)19-4-3-15-20-13-2-1-12(21)8-14(13)23-15/h1-2,5-8,21H,3-4H2,(H,19,22) |
| InChIKey | ODAHQJNFYBWNHL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |