C9H9N3O4S — CID 143516360
N-[6-(dihydroxyamino)-1,3-benzothiazol-2-yl]-2-hydroxyacetamide (PubChem CID 143516360) has the molecular formula C9H9N3O4S and a molecular weight of 255.25 g/mol. Its IUPAC name is N-[6-(dihydroxyamino)-1,3-benzothiazol-2-yl]-2-hydroxyacetamide.
| Compound Name | N-[6-(dihydroxyamino)-1,3-benzothiazol-2-yl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 143516360 |
| Molecular Formula | C9H9N3O4S |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | N-[6-(dihydroxyamino)-1,3-benzothiazol-2-yl]-2-hydroxyacetamide |
| SMILES | O=C(CO)Nc1nc2ccc(N(O)O)cc2s1 |
| InChI | InChI=1S/C9H9N3O4S/c13-4-8(14)11-9-10-6-2-1-5(12(15)16)3-7(6)17-9/h1-3,13,15-16H,4H2,(H,10,11,14) |
| InChIKey | RPSZTTQBFMTIKE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|