C15H22N4S — CID 114515038
2-N-[2-(1-methylpiperidin-4-yl)ethyl]-1,3-benzothiazole-2,6-diamine (PubChem CID 114515038) has the molecular formula C15H22N4S and a molecular weight of 290.44 g/mol. Its IUPAC name is 2-N-[2-(1-methylpiperidin-4-yl)ethyl]-1,3-benzothiazole-2,6-diamine.
| Compound Name | 2-N-[2-(1-methylpiperidin-4-yl)ethyl]-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 114515038 |
| Molecular Formula | C15H22N4S |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-N-[2-(1-methylpiperidin-4-yl)ethyl]-1,3-benzothiazole-2,6-diamine |
| SMILES | CN1CCC(CCNc2nc3ccc(N)cc3s2)CC1 |
| InChI | InChI=1S/C15H22N4S/c1-19-8-5-11(6-9-19)4-7-17-15-18-13-3-2-12(16)10-14(13)20-15/h2-3,10-11H,4-9,16H2,1H3,(H,17,18) |
| InChIKey | AFCQRRKBJSQTMR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|