C13H17ClN2OS — CID 79526073
N-(2-butoxyethyl)-6-chloro-1,3-benzothiazol-2-amine (PubChem CID 79526073) has the molecular formula C13H17ClN2OS and a molecular weight of 284.81 g/mol. Its IUPAC name is N-(2-butoxyethyl)-6-chloro-1,3-benzothiazol-2-amine.
| Compound Name | N-(2-butoxyethyl)-6-chloro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79526073 |
| Molecular Formula | C13H17ClN2OS |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-(2-butoxyethyl)-6-chloro-1,3-benzothiazol-2-amine |
| SMILES | CCCCOCCNc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C13H17ClN2OS/c1-2-3-7-17-8-6-15-13-16-11-5-4-10(14)9-12(11)18-13/h4-5,9H,2-3,6-8H2,1H3,(H,15,16) |
| InChIKey | JXZVJTZQLRMOGS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|