C9H9N3OS — CID 20696220
N-[(6-methyl-1,3-benzothiazol-2-yl)amino]formamide (PubChem CID 20696220) has the molecular formula C9H9N3OS and a molecular weight of 207.26 g/mol. Its IUPAC name is N-[(6-methyl-1,3-benzothiazol-2-yl)amino]formamide.
| Compound Name | N-[(6-methyl-1,3-benzothiazol-2-yl)amino]formamide |
|---|---|
| PubChem CID | 20696220 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | N-[(6-methyl-1,3-benzothiazol-2-yl)amino]formamide |
| SMILES | Cc1ccc2nc(NNC=O)sc2c1 |
| InChI | InChI=1S/C9H9N3OS/c1-6-2-3-7-8(4-6)14-9(11-7)12-10-5-13/h2-5H,1H3,(H,10,13)(H,11,12) |
| InChIKey | ZTOUYDDHWCJLCW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|