C14H14N2OS — CID 47143968
(2E,4E)-N-(6-methyl-1,3-benzothiazol-2-yl)hexa-2,4-dienamide (PubChem CID 47143968) has the molecular formula C14H14N2OS and a molecular weight of 258.35 g/mol. Its IUPAC name is (2E,4E)-N-(6-methyl-1,3-benzothiazol-2-yl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(6-methyl-1,3-benzothiazol-2-yl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 47143968 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | (2E,4E)-N-(6-methyl-1,3-benzothiazol-2-yl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1nc2ccc(C)cc2s1 |
| InChI | InChI=1S/C14H14N2OS/c1-3-4-5-6-13(17)16-14-15-11-8-7-10(2)9-12(11)18-14/h3-9H,1-2H3,(H,15,16,17)/b4-3+,6-5+ |
| InChIKey | RDHKJZYDGHNXKK-VNKDHWASSA-N |
| XLogP | 3.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|