C17H13IN2OS — CID 6056994
(E)-3-(3-iodophenyl)-N-(6-methyl-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 6056994) has the molecular formula C17H13IN2OS and a molecular weight of 420.28 g/mol. Its IUPAC name is (E)-3-(3-iodophenyl)-N-(6-methyl-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(3-iodophenyl)-N-(6-methyl-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6056994 |
| Molecular Formula | C17H13IN2OS |
| Molecular Weight | 420.28 g/mol |
| Exact Mass | 419.98 |
| IUPAC Name | (E)-3-(3-iodophenyl)-N-(6-methyl-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | Cc1ccc2nc(NC(=O)/C=C/c3cccc(I)c3)sc2c1 |
| InChI | InChI=1S/C17H13IN2OS/c1-11-5-7-14-15(9-11)22-17(19-14)20-16(21)8-6-12-3-2-4-13(18)10-12/h2-10H,1H3,(H,19,20,21)/b8-6+ |
| InChIKey | JJBYCGWYRGVFJT-SOFGYWHQSA-N |
| XLogP | 4.86 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.28 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|