C15H18N2OS — CID 72689787
4,4-dimethyl-N-(6-methyl-1,3-benzothiazol-2-yl)pent-2-enamide (PubChem CID 72689787) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 4,4-dimethyl-N-(6-methyl-1,3-benzothiazol-2-yl)pent-2-enamide.
| Compound Name | 4,4-dimethyl-N-(6-methyl-1,3-benzothiazol-2-yl)pent-2-enamide |
|---|---|
| PubChem CID | 72689787 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 4,4-dimethyl-N-(6-methyl-1,3-benzothiazol-2-yl)pent-2-enamide |
| SMILES | Cc1ccc2nc(NC(=O)C=CC(C)(C)C)sc2c1 |
| InChI | InChI=1S/C15H18N2OS/c1-10-5-6-11-12(9-10)19-14(16-11)17-13(18)7-8-15(2,3)4/h5-9H,1-4H3,(H,16,17,18) |
| InChIKey | ADUCIEBLCMXPAG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|