C16H15BrN2OS — CID 81288755
N-(4-bromo-2-ethylphenyl)-6-methoxy-1,3-benzothiazol-2-amine (PubChem CID 81288755) has the molecular formula C16H15BrN2OS and a molecular weight of 363.28 g/mol. Its IUPAC name is N-(4-bromo-2-ethylphenyl)-6-methoxy-1,3-benzothiazol-2-amine.
| Compound Name | N-(4-bromo-2-ethylphenyl)-6-methoxy-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 81288755 |
| Molecular Formula | C16H15BrN2OS |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | N-(4-bromo-2-ethylphenyl)-6-methoxy-1,3-benzothiazol-2-amine |
| SMILES | CCc1cc(Br)ccc1Nc1nc2ccc(OC)cc2s1 |
| InChI | InChI=1S/C16H15BrN2OS/c1-3-10-8-11(17)4-6-13(10)18-16-19-14-7-5-12(20-2)9-15(14)21-16/h4-9H,3H2,1-2H3,(H,18,19) |
| InChIKey | XDWMKNLTMRKIQS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |