C15H14N4O — CID 39749767
4-(2-cyclopropyl-1,3-benzoxazol-5-yl)-6-methylpyrimidin-2-amine (PubChem CID 39749767) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-(2-cyclopropyl-1,3-benzoxazol-5-yl)-6-methylpyrimidin-2-amine.
| Compound Name | 4-(2-cyclopropyl-1,3-benzoxazol-5-yl)-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 39749767 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 4-(2-cyclopropyl-1,3-benzoxazol-5-yl)-6-methylpyrimidin-2-amine |
| SMILES | Cc1cc(-c2ccc3oc(C4CC4)nc3c2)nc(N)n1 |
| InChI | InChI=1S/C15H14N4O/c1-8-6-11(19-15(16)17-8)10-4-5-13-12(7-10)18-14(20-13)9-2-3-9/h4-7,9H,2-3H2,1H3,(H2,16,17,19) |
| InChIKey | HHTBNBBFDAZQBB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |