C16H15F3N2O2 — CID 167449506
N-[2-(4,4-difluorocyclohexyl)-6-fluoro-1,3-benzoxazol-5-yl]prop-2-enamide (PubChem CID 167449506) has the molecular formula C16H15F3N2O2 and a molecular weight of 324.30 g/mol. Its IUPAC name is N-[2-(4,4-difluorocyclohexyl)-6-fluoro-1,3-benzoxazol-5-yl]prop-2-enamide.
| Compound Name | N-[2-(4,4-difluorocyclohexyl)-6-fluoro-1,3-benzoxazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 167449506 |
| Molecular Formula | C16H15F3N2O2 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N-[2-(4,4-difluorocyclohexyl)-6-fluoro-1,3-benzoxazol-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2nc(C3CCC(F)(F)CC3)oc2cc1F |
| InChI | InChI=1S/C16H15F3N2O2/c1-2-14(22)20-11-8-12-13(7-10(11)17)23-15(21-12)9-3-5-16(18,19)6-4-9/h2,7-9H,1,3-6H2,(H,20,22) |
| InChIKey | DKDFJYRCVASKHN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|