C10H7F2NO — CID 82230076
2-cyclopropyl-5,7-difluoro-1,3-benzoxazole (PubChem CID 82230076) has the molecular formula C10H7F2NO and a molecular weight of 195.17 g/mol. Its IUPAC name is 2-cyclopropyl-5,7-difluoro-1,3-benzoxazole.
| Compound Name | 2-cyclopropyl-5,7-difluoro-1,3-benzoxazole |
|---|---|
| PubChem CID | 82230076 |
| Molecular Formula | C10H7F2NO |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 2-cyclopropyl-5,7-difluoro-1,3-benzoxazole |
| SMILES | Fc1cc(F)c2oc(C3CC3)nc2c1 |
| InChI | InChI=1S/C10H7F2NO/c11-6-3-7(12)9-8(4-6)13-10(14-9)5-1-2-5/h3-5H,1-2H2 |
| InChIKey | ZZTGOCPBGYXYQY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |