C18H23N5O — CID 164909353
aniline;2-cyclohexyl-[1,3]oxazolo[4,5-b]pyridine-5,6-diamine (PubChem CID 164909353) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is aniline;2-cyclohexyl-[1,3]oxazolo[4,5-b]pyridine-5,6-diamine.
| Compound Name | aniline;2-cyclohexyl-[1,3]oxazolo[4,5-b]pyridine-5,6-diamine |
|---|---|
| PubChem CID | 164909353 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | aniline;2-cyclohexyl-[1,3]oxazolo[4,5-b]pyridine-5,6-diamine |
| SMILES | Nc1cc2oc(C3CCCCC3)nc2nc1N.Nc1ccccc1 |
| InChI | InChI=1S/C12H16N4O.C6H7N/c13-8-6-9-11(15-10(8)14)16-12(17-9)7-4-2-1-3-5-7;7-6-4-2-1-3-5-6/h6-7H,1-5,13H2,(H2,14,15);1-5H,7H2 |
| InChIKey | CLWOVRNXZCLXHY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 116.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|