C10H11N3O — CID 84661980
2-cyclobutyl-[1,3]oxazolo[4,5-b]pyridin-7-amine (PubChem CID 84661980) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 2-cyclobutyl-[1,3]oxazolo[4,5-b]pyridin-7-amine.
| Compound Name | 2-cyclobutyl-[1,3]oxazolo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 84661980 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 2-cyclobutyl-[1,3]oxazolo[4,5-b]pyridin-7-amine |
| SMILES | Nc1ccnc2nc(C3CCC3)oc12 |
| InChI | InChI=1S/C10H11N3O/c11-7-4-5-12-9-8(7)14-10(13-9)6-2-1-3-6/h4-6H,1-3H2,(H2,11,12) |
| InChIKey | VBBYYGVUSVSOGO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |