C11H9F3N2O2 — CID 86924240
3,3,3-trifluoro-N-(2-methyl-1,3-benzoxazol-6-yl)propanamide (PubChem CID 86924240) has the molecular formula C11H9F3N2O2 and a molecular weight of 258.20 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-(2-methyl-1,3-benzoxazol-6-yl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-(2-methyl-1,3-benzoxazol-6-yl)propanamide |
|---|---|
| PubChem CID | 86924240 |
| Molecular Formula | C11H9F3N2O2 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 3,3,3-trifluoro-N-(2-methyl-1,3-benzoxazol-6-yl)propanamide |
| SMILES | Cc1nc2ccc(NC(=O)CC(F)(F)F)cc2o1 |
| InChI | InChI=1S/C11H9F3N2O2/c1-6-15-8-3-2-7(4-9(8)18-6)16-10(17)5-11(12,13)14/h2-4H,5H2,1H3,(H,16,17) |
| InChIKey | VZMPGEYJZOOCIT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |