C13H14N2O4 — CID 115163815
5-[(2-methyl-1,3-benzoxazol-6-yl)amino]-5-oxopentanoic acid (PubChem CID 115163815) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 5-[(2-methyl-1,3-benzoxazol-6-yl)amino]-5-oxopentanoic acid.
| Compound Name | 5-[(2-methyl-1,3-benzoxazol-6-yl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 115163815 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 5-[(2-methyl-1,3-benzoxazol-6-yl)amino]-5-oxopentanoic acid |
| SMILES | Cc1nc2ccc(NC(=O)CCCC(=O)O)cc2o1 |
| InChI | InChI=1S/C13H14N2O4/c1-8-14-10-6-5-9(7-11(10)19-8)15-12(16)3-2-4-13(17)18/h5-7H,2-4H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | YPPZBMXVOYWHOX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |