C16H14N2O5S — CID 110759890
methyl 4-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]benzoate (PubChem CID 110759890) has the molecular formula C16H14N2O5S and a molecular weight of 346.36 g/mol. Its IUPAC name is methyl 4-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]benzoate.
| Compound Name | methyl 4-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 110759890 |
| Molecular Formula | C16H14N2O5S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | methyl 4-[(2-methyl-1,3-benzoxazol-6-yl)sulfonylamino]benzoate |
| SMILES | COC(=O)c1ccc(NS(=O)(=O)c2ccc3nc(C)oc3c2)cc1 |
| InChI | InChI=1S/C16H14N2O5S/c1-10-17-14-8-7-13(9-15(14)23-10)24(20,21)18-12-5-3-11(4-6-12)16(19)22-2/h3-9,18H,1-2H3 |
| InChIKey | FFUKGBRHJBTORQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |