C9H10N2O2S3 — CID 142682315
2-ethylsulfanyl-1,3-benzothiazole-6-sulfonamide (PubChem CID 142682315) has the molecular formula C9H10N2O2S3 and a molecular weight of 274.39 g/mol. Its IUPAC name is 2-ethylsulfanyl-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 2-ethylsulfanyl-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 142682315 |
| Molecular Formula | C9H10N2O2S3 |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 2-ethylsulfanyl-1,3-benzothiazole-6-sulfonamide |
| SMILES | CCSc1nc2ccc(S(N)(=O)=O)cc2s1 |
| InChI | InChI=1S/C9H10N2O2S3/c1-2-14-9-11-7-4-3-6(16(10,12)13)5-8(7)15-9/h3-5H,2H2,1H3,(H2,10,12,13) |
| InChIKey | CUAKYTYGXRUZOR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |