C23H31N2O5PS3 — CID 18551658
2-butylsulfanyl-N-(1-diethoxyphosphoryl-2-phenylethyl)-1,3-benzothiazole-6-sulfonamide (PubChem CID 18551658) has the molecular formula C23H31N2O5PS3 and a molecular weight of 542.69 g/mol. Its IUPAC name is 2-butylsulfanyl-N-(1-diethoxyphosphoryl-2-phenylethyl)-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 2-butylsulfanyl-N-(1-diethoxyphosphoryl-2-phenylethyl)-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 18551658 |
| Molecular Formula | C23H31N2O5PS3 |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | 2-butylsulfanyl-N-(1-diethoxyphosphoryl-2-phenylethyl)-1,3-benzothiazole-6-sulfonamide |
| SMILES | CCCCSc1nc2ccc(S(=O)(=O)NC(Cc3ccccc3)P(=O)(OCC)OCC)cc2s1 |
| InChI | InChI=1S/C23H31N2O5PS3/c1-4-7-15-32-23-24-20-14-13-19(17-21(20)33-23)34(27,28)25-22(16-18-11-9-8-10-12-18)31(26,29-5-2)30-6-3/h8-14,17,22,25H,4-7,15-16H2,1-3H3 |
| InChIKey | AICGACMOHASJAW-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|