C22H27N3O4S3 — CID 70023771
(2R)-2-[benzyl-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonyl]amino]-3-hydroxypropanamide (PubChem CID 70023771) has the molecular formula C22H27N3O4S3 and a molecular weight of 493.68 g/mol. Its IUPAC name is (2R)-2-[benzyl-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonyl]amino]-3-hydroxypropanamide.
| Compound Name | (2R)-2-[benzyl-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonyl]amino]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 70023771 |
| Molecular Formula | C22H27N3O4S3 |
| Molecular Weight | 493.68 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | (2R)-2-[benzyl-[(2-pentylsulfanyl-1,3-benzothiazol-6-yl)sulfonyl]amino]-3-hydroxypropanamide |
| SMILES | CCCCCSc1nc2ccc(S(=O)(=O)N(Cc3ccccc3)[C@H](CO)C(N)=O)cc2s1 |
| InChI | InChI=1S/C22H27N3O4S3/c1-2-3-7-12-30-22-24-18-11-10-17(13-20(18)31-22)32(28,29)25(19(15-26)21(23)27)14-16-8-5-4-6-9-16/h4-6,8-11,13,19,26H,2-3,7,12,14-15H2,1H3,(H2,23,27)/t19-/m1/s1 |
| InChIKey | KBBTZSZDXKVOCF-LJQANCHMSA-N |
| XLogP | 3.62 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.68 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|