C25H33N3O4S3 — CID 18551635
2-[(2-heptylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]-N-hydroxy-5-phenylpentanamide (PubChem CID 18551635) has the molecular formula C25H33N3O4S3 and a molecular weight of 535.76 g/mol. Its IUPAC name is 2-[(2-heptylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]-N-hydroxy-5-phenylpentanamide.
| Compound Name | 2-[(2-heptylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]-N-hydroxy-5-phenylpentanamide |
|---|---|
| PubChem CID | 18551635 |
| Molecular Formula | C25H33N3O4S3 |
| Molecular Weight | 535.76 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | 2-[(2-heptylsulfanyl-1,3-benzothiazol-6-yl)sulfonylamino]-N-hydroxy-5-phenylpentanamide |
| SMILES | CCCCCCCSc1nc2ccc(S(=O)(=O)NC(CCCc3ccccc3)C(=O)NO)cc2s1 |
| InChI | InChI=1S/C25H33N3O4S3/c1-2-3-4-5-9-17-33-25-26-21-16-15-20(18-23(21)34-25)35(31,32)28-22(24(29)27-30)14-10-13-19-11-7-6-8-12-19/h6-8,11-12,15-16,18,22,28,30H,2-5,9-10,13-14,17H2,1H3,(H,27,29) |
| InChIKey | BQVJSSNPTQJSMN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.76 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|