C22H28ClN3O5S — CID 162673720
(2S,3S)-2-[[2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-2-methylpropanoyl]amino]-N-hydroxy-3-methylpentanamide (PubChem CID 162673720) has the molecular formula C22H28ClN3O5S and a molecular weight of 482.00 g/mol. Its IUPAC name is (2S,3S)-2-[[2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-2-methylpropanoyl]amino]-N-hydroxy-3-methylpentanamide.
| Compound Name | (2S,3S)-2-[[2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-2-methylpropanoyl]amino]-N-hydroxy-3-methylpentanamide |
|---|---|
| PubChem CID | 162673720 |
| Molecular Formula | C22H28ClN3O5S |
| Molecular Weight | 482.00 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | (2S,3S)-2-[[2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-2-methylpropanoyl]amino]-N-hydroxy-3-methylpentanamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)C(C)(C)NS(=O)(=O)c1ccc(-c2ccc(Cl)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C22H28ClN3O5S/c1-5-14(2)19(20(27)25-29)24-21(28)22(3,4)26-32(30,31)18-12-8-16(9-13-18)15-6-10-17(23)11-7-15/h6-14,19,26,29H,5H2,1-4H3,(H,24,28)(H,25,27)/t14-,19-/m0/s1 |
| InChIKey | NVYOVRIROHPCAW-LIRRHRJNSA-N |
| XLogP | 3.10 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.00 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|