C15H25IN2O2S — CID 98788188
N-[(2R)-5-(diethylamino)pentan-2-yl]-4-iodobenzenesulfonamide (PubChem CID 98788188) has the molecular formula C15H25IN2O2S and a molecular weight of 424.35 g/mol. Its IUPAC name is N-[(2R)-5-(diethylamino)pentan-2-yl]-4-iodobenzenesulfonamide.
| Compound Name | N-[(2R)-5-(diethylamino)pentan-2-yl]-4-iodobenzenesulfonamide |
|---|---|
| PubChem CID | 98788188 |
| Molecular Formula | C15H25IN2O2S |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | N-[(2R)-5-(diethylamino)pentan-2-yl]-4-iodobenzenesulfonamide |
| SMILES | CCN(CC)CCC[C@@H](C)NS(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C15H25IN2O2S/c1-4-18(5-2)12-6-7-13(3)17-21(19,20)15-10-8-14(16)9-11-15/h8-11,13,17H,4-7,12H2,1-3H3/t13-/m1/s1 |
| InChIKey | OOHMGFVESXSZOQ-CYBMUJFWSA-N |
| XLogP | 3.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|