C9H12INO2S2 — CID 57133728
4-iodo-N-[(2R)-1-sulfanylpropan-2-yl]benzenesulfonamide (PubChem CID 57133728) has the molecular formula C9H12INO2S2 and a molecular weight of 357.24 g/mol. Its IUPAC name is 4-iodo-N-[(2R)-1-sulfanylpropan-2-yl]benzenesulfonamide.
| Compound Name | 4-iodo-N-[(2R)-1-sulfanylpropan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 57133728 |
| Molecular Formula | C9H12INO2S2 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.94 |
| IUPAC Name | 4-iodo-N-[(2R)-1-sulfanylpropan-2-yl]benzenesulfonamide |
| SMILES | C[C@H](CS)NS(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C9H12INO2S2/c1-7(6-14)11-15(12,13)9-4-2-8(10)3-5-9/h2-5,7,11,14H,6H2,1H3/t7-/m1/s1 |
| InChIKey | VXMAPWCVNCCCSS-SSDOTTSWSA-N |
| XLogP | 1.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|