C11H16ClIN2O4S — CID 86754155
(2S)-3-(ethylamino)-2-[(4-iodophenyl)sulfonylamino]propanoic acid;hydrochloride (PubChem CID 86754155) has the molecular formula C11H16ClIN2O4S and a molecular weight of 434.68 g/mol. Its IUPAC name is (2S)-3-(ethylamino)-2-[(4-iodophenyl)sulfonylamino]propanoic acid;hydrochloride.
| Compound Name | (2S)-3-(ethylamino)-2-[(4-iodophenyl)sulfonylamino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 86754155 |
| Molecular Formula | C11H16ClIN2O4S |
| Molecular Weight | 434.68 g/mol |
| Exact Mass | 433.96 |
| IUPAC Name | (2S)-3-(ethylamino)-2-[(4-iodophenyl)sulfonylamino]propanoic acid;hydrochloride |
| SMILES | CCNC[C@H](NS(=O)(=O)c1ccc(I)cc1)C(=O)O.Cl |
| InChI | InChI=1S/C11H15IN2O4S.ClH/c1-2-13-7-10(11(15)16)14-19(17,18)9-5-3-8(12)4-6-9;/h3-6,10,13-14H,2,7H2,1H3,(H,15,16);1H/t10-;/m0./s1 |
| InChIKey | LTSGXSRVRJGABJ-PPHPATTJSA-N |
| XLogP | 1.05 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.68 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|