C12H19NO2S2 — CID 22711635
4-propan-2-yl-N-(1-sulfanylpropan-2-yl)benzenesulfonamide (PubChem CID 22711635) has the molecular formula C12H19NO2S2 and a molecular weight of 273.42 g/mol. Its IUPAC name is 4-propan-2-yl-N-(1-sulfanylpropan-2-yl)benzenesulfonamide.
| Compound Name | 4-propan-2-yl-N-(1-sulfanylpropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 22711635 |
| Molecular Formula | C12H19NO2S2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 4-propan-2-yl-N-(1-sulfanylpropan-2-yl)benzenesulfonamide |
| SMILES | CC(CS)NS(=O)(=O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C12H19NO2S2/c1-9(2)11-4-6-12(7-5-11)17(14,15)13-10(3)8-16/h4-7,9-10,13,16H,8H2,1-3H3 |
| InChIKey | OPKYYLUPTNFPQD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|