C17H30N2O4S — CID 3667573
N-[5-(diethylamino)pentan-2-yl]-2,5-dimethoxybenzenesulfonamide (PubChem CID 3667573) has the molecular formula C17H30N2O4S and a molecular weight of 358.50 g/mol. Its IUPAC name is N-[5-(diethylamino)pentan-2-yl]-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-[5-(diethylamino)pentan-2-yl]-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 3667573 |
| Molecular Formula | C17H30N2O4S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N-[5-(diethylamino)pentan-2-yl]-2,5-dimethoxybenzenesulfonamide |
| SMILES | CCN(CC)CCCC(C)NS(=O)(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C17H30N2O4S/c1-6-19(7-2)12-8-9-14(3)18-24(20,21)17-13-15(22-4)10-11-16(17)23-5/h10-11,13-14,18H,6-9,12H2,1-5H3 |
| InChIKey | PAFKZLJYGUECAC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |