C19H33N3O4S — CID 7618202
N-[2-[[(2R)-5-(diethylamino)pentan-2-yl]sulfamoyl]ethyl]-4-methoxybenzamide (PubChem CID 7618202) has the molecular formula C19H33N3O4S and a molecular weight of 399.56 g/mol. Its IUPAC name is N-[2-[[(2R)-5-(diethylamino)pentan-2-yl]sulfamoyl]ethyl]-4-methoxybenzamide.
| Compound Name | N-[2-[[(2R)-5-(diethylamino)pentan-2-yl]sulfamoyl]ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 7618202 |
| Molecular Formula | C19H33N3O4S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-[2-[[(2R)-5-(diethylamino)pentan-2-yl]sulfamoyl]ethyl]-4-methoxybenzamide |
| SMILES | CCN(CC)CCC[C@@H](C)NS(=O)(=O)CCNC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H33N3O4S/c1-5-22(6-2)14-7-8-16(3)21-27(24,25)15-13-20-19(23)17-9-11-18(26-4)12-10-17/h9-12,16,21H,5-8,13-15H2,1-4H3,(H,20,23)/t16-/m1/s1 |
| InChIKey | YZYTUYBKIPQBAS-MRXNPFEDSA-N |
| XLogP | 1.85 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |