C16H26N3O2S+ — CID 8000368
[(4S)-4-[(4-cyanophenyl)sulfonylamino]pentyl]-diethylazanium (PubChem CID 8000368) has the molecular formula C16H26N3O2S+ and a molecular weight of 324.47 g/mol. Its IUPAC name is [(4S)-4-[(4-cyanophenyl)sulfonylamino]pentyl]-diethylazanium.
| Compound Name | [(4S)-4-[(4-cyanophenyl)sulfonylamino]pentyl]-diethylazanium |
|---|---|
| PubChem CID | 8000368 |
| Molecular Formula | C16H26N3O2S+ |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | [(4S)-4-[(4-cyanophenyl)sulfonylamino]pentyl]-diethylazanium |
| SMILES | CC[NH+](CC)CCC[C@H](C)NS(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H25N3O2S/c1-4-19(5-2)12-6-7-14(3)18-22(20,21)16-10-8-15(13-17)9-11-16/h8-11,14,18H,4-7,12H2,1-3H3/p+1/t14-/m0/s1 |
| InChIKey | KYVFHJDRNVCFSM-AWEZNQCLSA-O |
| XLogP | 0.93 |
| TPSA | 74.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |