C16H29N2O3S+ — CID 7987249
diethyl-[(4S)-4-[(4-methoxyphenyl)sulfonylamino]pentyl]azanium (PubChem CID 7987249) has the molecular formula C16H29N2O3S+ and a molecular weight of 329.49 g/mol. Its IUPAC name is diethyl-[(4S)-4-[(4-methoxyphenyl)sulfonylamino]pentyl]azanium.
| Compound Name | diethyl-[(4S)-4-[(4-methoxyphenyl)sulfonylamino]pentyl]azanium |
|---|---|
| PubChem CID | 7987249 |
| Molecular Formula | C16H29N2O3S+ |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | diethyl-[(4S)-4-[(4-methoxyphenyl)sulfonylamino]pentyl]azanium |
| SMILES | CC[NH+](CC)CCC[C@H](C)NS(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H28N2O3S/c1-5-18(6-2)13-7-8-14(3)17-22(19,20)16-11-9-15(21-4)10-12-16/h9-12,14,17H,5-8,13H2,1-4H3/p+1/t14-/m0/s1 |
| InChIKey | KKGJMWQWEGPEEO-AWEZNQCLSA-O |
| XLogP | 1.07 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |