C16H28BrN2O2S+ — CID 8716847
[(4R)-4-[(4-bromo-3-methylphenyl)sulfonylamino]pentyl]-diethylazanium (PubChem CID 8716847) has the molecular formula C16H28BrN2O2S+ and a molecular weight of 392.38 g/mol. Its IUPAC name is [(4R)-4-[(4-bromo-3-methylphenyl)sulfonylamino]pentyl]-diethylazanium.
| Compound Name | [(4R)-4-[(4-bromo-3-methylphenyl)sulfonylamino]pentyl]-diethylazanium |
|---|---|
| PubChem CID | 8716847 |
| Molecular Formula | C16H28BrN2O2S+ |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | [(4R)-4-[(4-bromo-3-methylphenyl)sulfonylamino]pentyl]-diethylazanium |
| SMILES | CC[NH+](CC)CCC[C@@H](C)NS(=O)(=O)c1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C16H27BrN2O2S/c1-5-19(6-2)11-7-8-14(4)18-22(20,21)15-9-10-16(17)13(3)12-15/h9-10,12,14,18H,5-8,11H2,1-4H3/p+1/t14-/m1/s1 |
| InChIKey | VWUZCQCREJOHRB-CQSZACIVSA-O |
| XLogP | 2.13 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |