C18H30N2O4S — CID 7516518
3-[[(2R)-5-(diethylazaniumyl)pentan-2-yl]sulfamoyl]-4,5-dimethylbenzoate (PubChem CID 7516518) has the molecular formula C18H30N2O4S and a molecular weight of 370.52 g/mol. Its IUPAC name is 3-[[(2R)-5-(diethylazaniumyl)pentan-2-yl]sulfamoyl]-4,5-dimethylbenzoate.
| Compound Name | 3-[[(2R)-5-(diethylazaniumyl)pentan-2-yl]sulfamoyl]-4,5-dimethylbenzoate |
|---|---|
| PubChem CID | 7516518 |
| Molecular Formula | C18H30N2O4S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 3-[[(2R)-5-(diethylazaniumyl)pentan-2-yl]sulfamoyl]-4,5-dimethylbenzoate |
| SMILES | CC[NH+](CC)CCC[C@@H](C)NS(=O)(=O)c1cc(C(=O)[O-])cc(C)c1C |
| InChI | InChI=1S/C18H30N2O4S/c1-6-20(7-2)10-8-9-14(4)19-25(23,24)17-12-16(18(21)22)11-13(3)15(17)5/h11-12,14,19H,6-10H2,1-5H3,(H,21,22)/t14-/m1/s1 |
| InChIKey | GHIIVVBDXXRKJS-CQSZACIVSA-N |
| XLogP | 0.04 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |