C12H16N2O2S2 — CID 113239018
4-cyano-N-(4-methylsulfanylbutan-2-yl)benzenesulfonamide (PubChem CID 113239018) has the molecular formula C12H16N2O2S2 and a molecular weight of 284.41 g/mol. Its IUPAC name is 4-cyano-N-(4-methylsulfanylbutan-2-yl)benzenesulfonamide.
| Compound Name | 4-cyano-N-(4-methylsulfanylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 113239018 |
| Molecular Formula | C12H16N2O2S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 4-cyano-N-(4-methylsulfanylbutan-2-yl)benzenesulfonamide |
| SMILES | CSCCC(C)NS(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C12H16N2O2S2/c1-10(7-8-17-2)14-18(15,16)12-5-3-11(9-13)4-6-12/h3-6,10,14H,7-8H2,1-2H3 |
| InChIKey | NAWBLYJZFMYXRV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |