C9H17N3O3S2 — CID 103861135
N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-1-methylpyrazole-4-sulfonamide (PubChem CID 103861135) has the molecular formula C9H17N3O3S2 and a molecular weight of 279.39 g/mol. Its IUPAC name is N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-1-methylpyrazole-4-sulfonamide.
| Compound Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 103861135 |
| Molecular Formula | C9H17N3O3S2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-1-methylpyrazole-4-sulfonamide |
| SMILES | CSC(CO)C(C)NS(=O)(=O)c1cnn(C)c1 |
| InChI | InChI=1S/C9H17N3O3S2/c1-7(9(6-13)16-3)11-17(14,15)8-4-10-12(2)5-8/h4-5,7,9,11,13H,6H2,1-3H3 |
| InChIKey | YTKTUHCRVLWKCR-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |