C20H22N2O6S — CID 133235289
3-(2,5-dioxopyrrolidin-1-yl)-4-methoxy-N-(1-phenoxypropan-2-yl)benzenesulfonamide (PubChem CID 133235289) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-4-methoxy-N-(1-phenoxypropan-2-yl)benzenesulfonamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-4-methoxy-N-(1-phenoxypropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 133235289 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-4-methoxy-N-(1-phenoxypropan-2-yl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C)COc2ccccc2)cc1N1C(=O)CCC1=O |
| InChI | InChI=1S/C20H22N2O6S/c1-14(13-28-15-6-4-3-5-7-15)21-29(25,26)16-8-9-18(27-2)17(12-16)22-19(23)10-11-20(22)24/h3-9,12,14,21H,10-11,13H2,1-2H3 |
| InChIKey | DOMVRWMLBUPKNJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|