C17H20FNO5S — CID 30387494
3-fluoro-4-methoxy-N-[(2S)-1-(4-methoxyphenoxy)propan-2-yl]benzenesulfonamide (PubChem CID 30387494) has the molecular formula C17H20FNO5S and a molecular weight of 369.41 g/mol. Its IUPAC name is 3-fluoro-4-methoxy-N-[(2S)-1-(4-methoxyphenoxy)propan-2-yl]benzenesulfonamide.
| Compound Name | 3-fluoro-4-methoxy-N-[(2S)-1-(4-methoxyphenoxy)propan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 30387494 |
| Molecular Formula | C17H20FNO5S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 3-fluoro-4-methoxy-N-[(2S)-1-(4-methoxyphenoxy)propan-2-yl]benzenesulfonamide |
| SMILES | COc1ccc(OC[C@H](C)NS(=O)(=O)c2ccc(OC)c(F)c2)cc1 |
| InChI | InChI=1S/C17H20FNO5S/c1-12(11-24-14-6-4-13(22-2)5-7-14)19-25(20,21)15-8-9-17(23-3)16(18)10-15/h4-10,12,19H,11H2,1-3H3/t12-/m0/s1 |
| InChIKey | PDOLHCNLJZJCRX-LBPRGKRZSA-N |
| XLogP | 2.59 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |