C22H25NO3S — CID 124886214
N-[(2R)-1-(4-propan-2-ylphenoxy)propan-2-yl]naphthalene-2-sulfonamide (PubChem CID 124886214) has the molecular formula C22H25NO3S and a molecular weight of 383.51 g/mol. Its IUPAC name is N-[(2R)-1-(4-propan-2-ylphenoxy)propan-2-yl]naphthalene-2-sulfonamide.
| Compound Name | N-[(2R)-1-(4-propan-2-ylphenoxy)propan-2-yl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 124886214 |
| Molecular Formula | C22H25NO3S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-[(2R)-1-(4-propan-2-ylphenoxy)propan-2-yl]naphthalene-2-sulfonamide |
| SMILES | CC(C)c1ccc(OC[C@@H](C)NS(=O)(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C22H25NO3S/c1-16(2)18-8-11-21(12-9-18)26-15-17(3)23-27(24,25)22-13-10-19-6-4-5-7-20(19)14-22/h4-14,16-17,23H,15H2,1-3H3/t17-/m1/s1 |
| InChIKey | ZHQYQXCMMBRAPX-QGZVFWFLSA-N |
| XLogP | 4.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |