C23H25NO2 — CID 892675
N-[(2S)-1-(4-propan-2-ylphenoxy)propan-2-yl]naphthalene-2-carboxamide (PubChem CID 892675) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[(2S)-1-(4-propan-2-ylphenoxy)propan-2-yl]naphthalene-2-carboxamide.
| Compound Name | N-[(2S)-1-(4-propan-2-ylphenoxy)propan-2-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 892675 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | N-[(2S)-1-(4-propan-2-ylphenoxy)propan-2-yl]naphthalene-2-carboxamide |
| SMILES | CC(C)c1ccc(OC[C@H](C)NC(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C23H25NO2/c1-16(2)18-10-12-22(13-11-18)26-15-17(3)24-23(25)21-9-8-19-6-4-5-7-20(19)14-21/h4-14,16-17H,15H2,1-3H3,(H,24,25)/t17-/m0/s1 |
| InChIKey | OPJCCLLHXSAUIU-KRWDZBQOSA-N |
| XLogP | 5.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |