C19H26N2O5S — CID 100608093
N-cyclooctyl-3-(2,5-dioxopyrrolidin-1-yl)-4-methoxybenzenesulfonamide (PubChem CID 100608093) has the molecular formula C19H26N2O5S and a molecular weight of 394.49 g/mol. Its IUPAC name is N-cyclooctyl-3-(2,5-dioxopyrrolidin-1-yl)-4-methoxybenzenesulfonamide.
| Compound Name | N-cyclooctyl-3-(2,5-dioxopyrrolidin-1-yl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 100608093 |
| Molecular Formula | C19H26N2O5S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-cyclooctyl-3-(2,5-dioxopyrrolidin-1-yl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CCCCCCC2)cc1N1C(=O)CCC1=O |
| InChI | InChI=1S/C19H26N2O5S/c1-26-17-10-9-15(13-16(17)21-18(22)11-12-19(21)23)27(24,25)20-14-7-5-3-2-4-6-8-14/h9-10,13-14,20H,2-8,11-12H2,1H3 |
| InChIKey | YNICSXWRAGYLQK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|