C20H19ClN2O4S — CID 1075667
4-chloro-2,5-dimethoxy-N-[4-(pyridin-4-ylmethyl)phenyl]benzenesulfonamide (PubChem CID 1075667) has the molecular formula C20H19ClN2O4S and a molecular weight of 418.90 g/mol. Its IUPAC name is 4-chloro-2,5-dimethoxy-N-[4-(pyridin-4-ylmethyl)phenyl]benzenesulfonamide.
| Compound Name | 4-chloro-2,5-dimethoxy-N-[4-(pyridin-4-ylmethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 1075667 |
| Molecular Formula | C20H19ClN2O4S |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 4-chloro-2,5-dimethoxy-N-[4-(pyridin-4-ylmethyl)phenyl]benzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)Nc2ccc(Cc3ccncc3)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C20H19ClN2O4S/c1-26-18-13-20(19(27-2)12-17(18)21)28(24,25)23-16-5-3-14(4-6-16)11-15-7-9-22-10-8-15/h3-10,12-13,23H,11H2,1-2H3 |
| InChIKey | FWEIHKKWDFQWEY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |