C21H23FN2O3S — CID 90485102
ethanol;5-fluoro-2-methyl-N-[4-(pyridin-4-ylmethyl)phenyl]benzenesulfonamide (PubChem CID 90485102) has the molecular formula C21H23FN2O3S and a molecular weight of 402.49 g/mol. Its IUPAC name is ethanol;5-fluoro-2-methyl-N-[4-(pyridin-4-ylmethyl)phenyl]benzenesulfonamide.
| Compound Name | ethanol;5-fluoro-2-methyl-N-[4-(pyridin-4-ylmethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90485102 |
| Molecular Formula | C21H23FN2O3S |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | ethanol;5-fluoro-2-methyl-N-[4-(pyridin-4-ylmethyl)phenyl]benzenesulfonamide |
| SMILES | CCO.Cc1ccc(F)cc1S(=O)(=O)Nc1ccc(Cc2ccncc2)cc1 |
| InChI | InChI=1S/C19H17FN2O2S.C2H6O/c1-14-2-5-17(20)13-19(14)25(23,24)22-18-6-3-15(4-7-18)12-16-8-10-21-11-9-16;1-2-3/h2-11,13,22H,12H2,1H3;3H,2H2,1H3 |
| InChIKey | OBTICKJDKCJBNX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |